On Target NPY1R_HUMAN 0.33333334/CHEMBL2046862
For the given ligand C64, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL2046862. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL2046862 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | COc1ccc(cc1)[C@@]2([C@@H]3C[C@@H](C)C[C@H]23)N4CCN(CC4)c5ccccc5 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00004002 01000008 2010012a 04010600 00001000 00000000 02040000 22001000 00000800 00090ac0 08300004 40018000 00000802 01202000 01000441 00000008 00040000 02000000 0a002000 00020201 40100100 38008010 20000021 02500012 00000000 c0000000 00320000 90000080 08008302 01060002 00060000 00000600 |