On Target DRD4_HUMAN 0.46376812/CHEMBL194755
For the given ligand C64, we have found in our database that, being scored 0.46376812, the most similar ligand is CHEMBL194755. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL194755 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | COc1ccccc1N2CCN(CCCCNS(=O)(=O)c3ccc(F)cc3)CC2 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00004012 02808008 21100028 07b10600 80081000 00000010 02000800 20000000 00200000 00400ac0 40202004 60028000 00000002 00003001 81600041 00004008 00042000 00000000 08400000 00026601 c0100000 38000000 20000021 1a40801a 02000000 00000004 20000000 1000008d 08008600 20068000 00000800 00010270 |