On Target GRM5_HUMAN 0.3986014/CHEMBL4068775
For the given ligand C64, we have found in our database that, being scored 0.3986014, the most similar ligand is CHEMBL4068775. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL4068775 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | Cc1ccc(cc1)S(=O)(=O)c2cnc3ccccc3c2NCc4ccccc4 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 00005002 00801200 000a4100 01910600 00040000 00000000 00008000 02001000 00000000 00001840 00306005 6100c000 01000800 00410000 80600040 00040006 04041100 02000000 08200000 00002801 c0100000 08049008 20810000 88480019 00004008 80000080 40208010 800001a0 00008300 01060080 0004a040 00010360 |