On Target NPY4R_HUMAN 0.2195122/CHEMBL3559801
For the given ligand C64, we have found in our database that, being scored 0.2195122, the most similar ligand is CHEMBL3559801. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL3559801 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | CC(C)(C)c1ccc(OC2CCCCC2O)cc1 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 04000000 01000008 20000108 00010300 00081000 02000000 02040000 00000000 00000000 00080840 08000000 40008000 00800002 00800000 11200001 00082008 00800000 02000000 02402000 00020001 00000000 08000000 05000000 08400010 00000000 80000000 00120000 00800000 00000200 00020002 00000000 00000400 |