On Target NK2R_HUMAN 0.3243243/CHEMBL280789
For the given ligand C64, we have found in our database that, being scored 0.3243243, the most similar ligand is CHEMBL280789. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL280789 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | CS(=O)(=O)N1CC2(CCN(CCCC3(CCC(=O)N(Cc4ccccc4)C3)c5ccc(Cl)c(Cl)c5)CC2)c6ccccc16 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 0001c042 27801200 00100902 01310600 20000000 00002000 06010000 22001004 00300880 004808c0 08302004 50039800 06008c3f 00200001 804a0540 00060000 00068000 02000000 08002008 00004201 c0100100 18a48f30 20000000 915c0019 02002080 c0100000 00040000 9000108c 04008100 0006000b 20060080 20432670 |