On Target V1AR_HUMAN 0.5273973/CHEMBL200682
For the given ligand C64, we have found in our database that, being scored 0.5273973, the most similar ligand is CHEMBL200682. Check out the elaboration below.
| C64 (Given Ligand) | CHEMBL200682 (Similar Ligand) |
|---|---|
| CCN(CC)c3ccc(CN(c1ccc(C)cc1)S(=O)(=O)c2ccc(OC)cc2)cc3 | COc1ccc(cc1)N(CC(=O)Nc2ccc(Cl)cc2C)S(=O)(=O)c3ccccc3 |
|
|
|
|
|
|
| 00004012 00804808 2108010a 81b10600 00081000 00000000 06000001 02001000 00000000 00001840 00302004 6000c000 00040c02 00008001 81280041 00020008 00042000 02100000 08400800 00026000 c0100000 08008800 20050040 08400008 02000080 80000004 40800000 8000008c 00008700 20060000 00040000 00010360 | 0000c092 00800008 2100012a 01b10600 00089000 00000040 06020000 00000008 00000000 00000a40 00282004 6000a800 02048426 00102001 812a0041 00028008 00242000 02000000 08600000 00026400 c0140000 28000f01 20042040 2940002a 02002080 80000084 000c0010 0000108c 08008600 20060001 00005002 02130260 |