On Target BKRB2_HUMAN 0.24358974/CHEMBL121565
For the given ligand test, we have found in our database that, being scored 0.24358974, the most similar ligand is CHEMBL121565. Check out the elaboration below.
| test (Given Ligand) | CHEMBL121565 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | [Cl-].[Cl-].CCCCC[P+](CCCCC)(CCCCC)Cc1ccc(cc1)C(=O)c2ccc(C[P+](CCCCC)(CCCCC)CCCCC)cc2 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00000000 01000a00 00000100 40010200 00000000 00000000 00000000 25000000 00000500 00080840 08000001 40108800 00008200 00000000 02010000 00000000 02001008 02000000 00004000 00000201 00000000 08020200 00000000 20400014 00000000 a0010002 00002000 40000000 00000280 00020302 90040000 0002c400 |