On Target MSHR_HUMAN 0.24409449/CHEMBL1093307
For the given ligand test, we have found in our database that, being scored 0.24409449, the most similar ligand is CHEMBL1093307. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1093307 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | CC(=O)NC(C)(C)[C@H]1CC2(CCN(CC2)C(=O)[C@H]3CN(C[C@@H]3c4ccc(F)cc4F)C(C)(C)C)c5cc(Cl)c(C)cc15 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00028000 05001600 00100102 02010600 00001621 00000012 04000000 20040005 00300980 000909e0 08300000 d0839800 0e008026 00201000 80000000 020e0008 01000200 02008080 00002018 00100201 00000104 18240710 01004000 81540018 00003800 80000201 00040000 10000001 04000002 0006801b 00020000 00822600 |