On Target CXCR3_HUMAN 0.3298969/CHEMBL2205063
For the given ligand test, we have found in our database that, being scored 0.3298969, the most similar ligand is CHEMBL2205063. Check out the elaboration below.
| test (Given Ligand) | CHEMBL2205063 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | [I-].CC(=O)c1cccc(c1)c2ccc(C[N+](C)(C)CC3=CC[C@H]4C[C@@H]3C4(C)C)cc2 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00002010 01008800 00100100 00010600 00000001 00000000 00100000 22001402 00000100 001808c0 08200000 40018000 80028902 00010010 00000400 08080108 20020000 02001120 04002000 10000201 00000000 18028210 10008000 00500014 00200000 c0000080 00484200 90000041 10004100 00060002 a4260000 00000600 |