On Target GRM7_HUMAN 0.29896906/CHEMBL432038
For the given ligand test, we have found in our database that, being scored 0.29896906, the most similar ligand is CHEMBL432038. Check out the elaboration below.
| test (Given Ligand) | CHEMBL432038 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | N[C@@](CC1c2ccccc2Oc3ccccc13)([C@H]4C[C@@H]4C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00030000 01000208 2000010a 00018600 00181000 00000000 02000000 01000200 00000804 000a08c0 08100000 4001b040 0400803a 03a00000 01000001 00082008 00000000 02000000 00402000 00020001 00400100 18000a00 03000000 06400410 00000000 e0000000 00000000 40200000 00000382 0006c00a 02020400 00400400 |