On Target OPRK_HUMAN 0.42857143/CHEMBL3809091
For the given ligand test, we have found in our database that, being scored 0.42857143, the most similar ligand is CHEMBL3809091. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3809091 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | CN(C)C[C@H]1CCc2cc(ccc2[C@]1(O)c3cccc(O)c3)c4ccccc4 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00002000 4b000208 20100102 00050600 00080001 40004002 02000400 01000001 00100900 000808c0 08300000 40018800 00000002 00200000 00000020 020c0008 00020200 02001000 04d02000 10020201 00000500 18000020 11004080 00520010 00000000 a0000281 00000000 50000041 02004082 0006000a 40000000 00000600 |