On Target HRH3_HUMAN 0.5492958/CHEMBL3402682
For the given ligand test, we have found in our database that, being scored 0.5492958, the most similar ligand is CHEMBL3402682. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3402682 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | Cl.CN(C)[C@H]1C[C@H](c2cccc(c2)c3ccccc3)c4ccccc4C1 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00002000 01000200 00100102 00010600 00000021 00000002 00000400 01000001 00000800 000808c0 08300000 40808200 00000000 00200000 00000000 020c0008 00020200 02001000 04102000 00000001 00000100 18200000 11004000 81400010 00000000 a0000081 00000000 50000041 06004082 0006000a 00000000 00020600 |