On Target ADRB3_HUMAN 0.45348838/CHEMBL456971
For the given ligand test, we have found in our database that, being scored 0.45348838, the most similar ligand is CHEMBL456971. Check out the elaboration below.
| test (Given Ligand) | CHEMBL456971 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | Cc1ccc(cc1)[C@@H](O)CN[C@H]2CCc3ccc(cc3C2)c4ccc(cc4)C(=O)O |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00002000 01000a00 00100102 40050600 000010a1 00004000 00000000 20000001 00000980 000808c0 08300000 40808800 00008002 00200000 00080000 020c0008 10020200 02001000 04002000 10000201 00000100 18220a20 13004000 81400014 00000000 80000081 00000000 10000041 04004002 0006000a c0000000 00002600 |