On Target MC4R_HUMAN 0.41935483/CHEMBL194464
For the given ligand test, we have found in our database that, being scored 0.41935483, the most similar ligand is CHEMBL194464. Check out the elaboration below.
| test (Given Ligand) | CHEMBL194464 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | CCN(CC)CC(CCCc1ccccc1)N2CCN(C)CC2 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00000000 01000000 00100102 04010600 00000000 00000000 00000000 20000000 00100800 000808c0 08300000 40018000 00000002 00202000 00000000 00000000 00000000 02000000 00002000 00000201 00000100 38000010 00000023 02500010 00000000 80000000 00000000 10000000 08000002 00060002 00000000 00000600 |