On Target GASR_HUMAN 0.24107143/CHEMBL1171596
For the given ligand test, we have found in our database that, being scored 0.24107143, the most similar ligand is CHEMBL1171596. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1171596 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | CCCC[C@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc2ccccc2)C(=O)N |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00070000 01003208 20100100 04010600 00100000 00000000 02000000 2000000c 00000880 000808c0 08300000 4001b000 0e00800a 00002001 80000000 000c0008 00000000 02000001 00c02018 00020201 00000100 38340e10 01000083 83500018 00001801 80000000 00120000 10000000 0c000002 0006000b 20004000 00802e00 |