On Target GABR1_HUMAN 0.1965812/CHEMBL2391908
For the given ligand test, we have found in our database that, being scored 0.1965812, the most similar ligand is CHEMBL2391908. Check out the elaboration below.
| test (Given Ligand) | CHEMBL2391908 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | Cl.C[C@H](NC[C@H](O)CP(=O)(O)CC1CCCCC1)c2ccc(Cl)c(Cl)c2 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00008008 0d000200 00100100 00010600 00000080 80000000 04000000 02001000 00000400 00080848 08200001 40108800 02000876 01060000 8e000400 00080008 1000002c 02300000 02006000 00000201 00000000 19108100 03400000 00480010 08002000 c0100000 00040000 80014000 00140b00 00060302 70060000 0102d601 |