On Target GRM5_HUMAN 0.15/CHEMBL371811
For the given ligand h, we have found in our database that, being scored 0.15, the most similar ligand is CHEMBL371811. Check out the elaboration below.
| h (Given Ligand) | CHEMBL371811 (Similar Ligand) |
|---|---|
| c1ccccc1 | Fc1cccc(\C=N\N=C\c2cccc(F)c2)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 00000000 | 00000000 00000000 00100100 02010200 04000000 00000010 00000000 01000000 00000100 00002841 20000000 50008000 80000000 00001000 00800000 00080000 00000000 02000000 00000400 40000000 00000000 18000000 00001000 00400000 00000000 80000800 40000000 00000001 00000008 000e8000 40000000 00001200 |