On Target MC3R_HUMAN 0.078947365/CHEMBL460349
For the given ligand h, we have found in our database that, being scored 0.078947365, the most similar ligand is CHEMBL460349. Check out the elaboration below.
| h (Given Ligand) | CHEMBL460349 (Similar Ligand) |
|---|---|
| c1ccccc1 | CC[C@@H]1N(CCN([C@@H](Cc2ccc3ccccc3c2)C(=O)NC)C1=O)C(=O)[C@H](N)Cc4ccc(F)cc4 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000200 00000000 00000000 00000000 00000000 00000000 00000840 00000000 00008000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 08000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 00000000 | 00000000 00003200 00100100 06010600 00000000 00000010 00000000 2000000c 00000880 000808c0 08300000 4000b000 06008002 00003001 80000000 00040000 00000000 02000080 00000008 00100201 00000100 38200608 00000023 83400018 00000800 80000000 00000000 10000001 0c000000 0006800b 20004000 00002600 |