On Target 5HT2C_HUMAN 0.36206895/CHEMBL474860
For the given ligand test, we have found in our database that, being scored 0.36206895, the most similar ligand is CHEMBL474860. Check out the elaboration below.
| test (Given Ligand) | CHEMBL474860 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | Cl.NC[C@H]1C[C@@H]1c2ccccc2c3ccc(F)cc3 |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00002000 01000201 00100102 02010600 00820000 00000010 00000000 00000000 00100800 000808c0 08100000 40018000 00000000 01201000 20000020 02000000 00020000 02000000 04000000 00100001 00000100 18000000 10004000 00400010 00800000 80000001 00000000 00000041 00004000 0006800a 00000000 00020600 |