On Target GRM8_HUMAN 0.17567568/CHEMBL143210
For the given ligand test, we have found in our database that, being scored 0.17567568, the most similar ligand is CHEMBL143210. Check out the elaboration below.
| test (Given Ligand) | CHEMBL143210 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | N[C@H](C(=O)O)c1ccc(C(=O)O)c(c1)C(=O)O |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00000000 00000800 00000100 40050600 00000041 0000c000 00000000 00001000 00000100 00080e40 68000000 4000b800 81008800 00200000 40040000 08080008 08000000 02000000 00100000 40000000 00000000 08028b20 03000000 00400014 00000000 80000800 08000000 00004004 00000000 00060002 c0042000 00000400 |