On Target OPRX_HUMAN 0.23333333/CHEMBL139816
For the given ligand test, we have found in our database that, being scored 0.23333333, the most similar ligand is CHEMBL139816. Check out the elaboration below.
| test (Given Ligand) | CHEMBL139816 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | Cc1cc(N)c2cc(NC(=O)c3ccccc3c4ccccc4)ccc2n1 |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 08006002 00801801 00004100 10010600 00040020 00008000 00008000 02001000 10400000 10000840 00280004 4000c000 00008800 00700000 20020040 02040004 00060000 02000008 0c200000 00400004 40120000 08068608 30812020 80400004 00040000 80000000 00008040 800000c0 0000c104 00060001 80040020 00000240 |