On Target CCKAR_HUMAN 0.16666667/CHEMBL1774034
For the given ligand test, we have found in our database that, being scored 0.16666667, the most similar ligand is CHEMBL1774034. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1774034 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | COc1ccc(cc1)c2cnc(nc2c3ccc(C)cc3)C(=O)N4CCN(CC4)c5ccc6ccccc6c5 |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 0000e002 00002809 20000128 14050e10 04001020 0010400a 02441000 00082049 00000100 00000a50 00298084 60008800 02008012 0830a000 21020041 800c010c 00060000 02002022 0c400000 50020000 40100000 28020608 30802060 0240010a 00140001 80080000 00020210 000010c0 0801c204 01660001 40000820 000042a0 |