On Target NPY5R_HUMAN 0.25/CHEMBL327027
For the given ligand test, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL327027. Check out the elaboration below.
| test (Given Ligand) | CHEMBL327027 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | c1ccc(cc1)c2c[nH]c(n2)c3ccccc3 |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00008002 00000000 00000100 10010210 00000040 00000008 00000000 00080040 00000100 10000850 00008000 40008800 02000000 00180000 00020000 800c0004 00020000 02002000 04000000 40400000 01000000 28000000 21002000 00400000 00040001 80080000 00000200 00001040 00014004 00620800 40000820 00000000 |