On Target NK1R_HUMAN 0.375/CHEMBL206490
For the given ligand test, we have found in our database that, being scored 0.375, the most similar ligand is CHEMBL206490. Check out the elaboration below.
| test (Given Ligand) | CHEMBL206490 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | FC(F)(F)c1cc(COCc2ccccc2c3ccccc3)cc(c1)C(F)(F)F |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 0000a000 000c0001 00100100 00010200 00000011 00004000 00100400 00000000 00000100 00400850 00000000 40008802 02000000 01210000 20000000 02080008 00020000 02000200 04000000 40000000 00000000 08000020 10000000 00400000 00000400 80002000 00080000 90000040 00004201 00020000 40100004 00000200 |