On Target NPSR1_HUMAN 0.17821783/CHEMBL1289780
For the given ligand test, we have found in our database that, being scored 0.17821783, the most similar ligand is CHEMBL1289780. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1289780 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | O=C(Nc1ccccc1C(=O)N2CCCCC2)c3cccc(c3)c4ccccc4 |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 10006002 01001800 00100100 00010600 00000001 04110040 10000000 22081000 00800000 200008c0 00280044 5001c000 00008802 00100000 00020440 08000008 00060000 03001002 0c000000 00800201 40100000 18068600 30012000 0054001c 00000000 c0000000 08000010 900010c1 1000c100 00060001 a0040000 40000200 |