On Target GRM6_HUMAN 0.1875/CHEMBL566136
For the given ligand test, we have found in our database that, being scored 0.1875, the most similar ligand is CHEMBL566136. Check out the elaboration below.
| test (Given Ligand) | CHEMBL566136 (Similar Ligand) |
|---|---|
| c3ccc(c1ccccc1c2ccccc2)cc3 | CCOC(=O)c1c(C)c(sc1N)c2ccccc2 |
|
|
|
|
|
|
| 00002000 00000001 00000100 00010200 00000000 00000000 00000000 00000000 00000000 00000840 00000080 40008000 00000000 00200000 20000000 00000000 00020000 02000000 04000000 00000000 00000000 08000000 10000000 00400000 00000000 80000000 00000000 00000040 00004000 00020000 00000000 00000000 | 00012002 00000801 00000900 00030200 00100010 00018000 40140180 08100008 20000100 00000841 00000204 c0089a80 00008018 00210081 28023801 0a080008 11020000 02001018 04020000 40010001 00000000 58020a80 30000000 00400104 02058408 84000010 00090000 00000245 10014209 00060480 c0100004 00c10000 |