On Target OPRD_HUMAN 0.08/CHEMBL4094512
For the given ligand test, we have found in our database that, being scored 0.08, the most similar ligand is CHEMBL4094512. Check out the elaboration below.
| test (Given Ligand) | CHEMBL4094512 (Similar Ligand) |
|---|---|
| CCCCC | Cl.Oc1ccc(CCN(CCc2cccc(O)c2)CC3CCC3)cc1 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000000 43000008 20100100 00010600 00000000 80000000 02000000 20000000 00000080 000808c0 08200000 40018000 00000002 00000010 00000000 00000008 00000000 02000000 00000000 00020201 00000000 18200000 00000000 81500010 00000000 80000000 00120000 10000000 04000000 00060002 00000000 00022600 |