On Target AA2BR_HUMAN 0.05263158/CHEMBL302344
For the given ligand test, we have found in our database that, being scored 0.05263158, the most similar ligand is CHEMBL302344. Check out the elaboration below.
| test (Given Ligand) | CHEMBL302344 (Similar Ligand) |
|---|---|
| CCCCC | O=C1Nc2[nH]cnc2C(=O)N1C3CCCC3 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0000002a 01801800 00080000 02000600 00080040 0000c040 00008000 00000000 06400100 800000a0 0c00800c 40010000 00009000 00c00000 00280080 000c000c 00000000 00008000 00400000 00000001 80000100 10000050 21800041 00300014 00040000 c0200000 60000000 00040000 00004000 01460000 c0080000 00000280 |