On Target BKRB2_HUMAN 0.5102041/CHEMBL109123
For the given ligand fEN, we have found in our database that, being scored 0.5102041, the most similar ligand is CHEMBL109123. Check out the elaboration below.
| fEN (Given Ligand) | CHEMBL109123 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | CN1CCC2(CC1)N(CCc3ccccc3)CN(CC(=O)C)C2=O |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00030000 01001400 00100100 04010e00 00000000 00000000 00000004 20002000 00200080 000809e0 08200000 5003b000 06009002 00002001 80000000 00000000 00000008 02002000 00000040 00000201 00000100 38210600 00000001 83500018 00010000 80000000 00000000 10000000 0c000000 00060013 20184000 00802600 |