On Target AA2AR_HUMAN 0.4728682/CHEMBL539454
For the given ligand fEN, we have found in our database that, being scored 0.4728682, the most similar ligand is CHEMBL539454. Check out the elaboration below.
| fEN (Given Ligand) | CHEMBL539454 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | CCCN(CCc1ccc(NC(=O)CCC(N)C(=O)NCCCCC(NC(=O)C(CCCCNC(=O)C)NC(=O)C)C(=O)N)cc1)C2CCc3c(O)cccc3C2 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00034002 43003a08 20100102 44010600 20000020 c0002000 02000000 20000209 00200880 000a08c0 08380004 4083b040 0600801a 0030a001 80020040 02042008 00040200 02000000 08002000 00020201 40100100 38240630 20006003 83500018 00000000 80000001 00000000 10000080 0c008002 0006c00b 20004000 00002600 |