On Target CXCR2_HUMAN 0.44117647/CHEMBL25573
For the given ligand Acetaminophen, we have found in our database that, being scored 0.44117647, the most similar ligand is CHEMBL25573. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL25573 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | Oc1cc(ccc1NC(=O)Nc2ccccc2)C#N |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00000006 40000808 20000100 00010a40 00000020 00000000 02000000 00002001 00000000 00800840 00280004 41008000 00008002 00108000 00000040 00004008 00440000 0a000000 08800000 00020200 40000100 08000400 20022400 00410000 00100000 80000000 20200040 00000080 00008000 00060401 00000000 00004000 |