On Target HRH4_HUMAN 0.30526316/CHEMBL128958
For the given ligand Acetaminophen, we have found in our database that, being scored 0.30526316, the most similar ligand is CHEMBL128958. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL128958 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CN1CCN(CC1)C(=O)c2cc3cc(O)ccc3[nH]2 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00000002 0000a808 20000100 14010e00 00040020 00100000 06000000 02003009 00000000 00010840 00290004 40008000 00008806 00502000 00020440 0204010c 00000000 02000006 00200000 00020200 40000000 28068608 20802020 8240000c 00102000 c0000000 00000000 80000000 08000104 00060001 80040200 00004200 |