On Target PTAFR_HUMAN 0.3181818/CHEMBL54106
For the given ligand Acetaminophen, we have found in our database that, being scored 0.3181818, the most similar ligand is CHEMBL54106. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL54106 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | COc1ccc(cc1)C(=C\C=C\C(=O)Nc2ccc(Cc3cccnc3)cc2)c4ccc(OC)cc4 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 08004202 0004c808 20004108 40010610 00041000 00000001 82042080 01000400 01400000 00080840 082c0004 60008008 00008802 20118000 01000043 0004000c 20050400 02000104 08290480 00020000 40100010 08008600 60802001 00400010 00040000 a0000000 08522000 40000080 00408280 080e0003 04000000 01000600 |