On Target HRH3_HUMAN 0.47887325/CHEMBL2387297
For the given ligand Acetaminophen, we have found in our database that, being scored 0.47887325, the most similar ligand is CHEMBL2387297. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL2387297 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CN(C)CCOc1ccc(NC(=O)Nc2ccc(Cl)cc2)cc1 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 0400a006 00000008 20000008 00000e42 00001080 00000000 02000000 00002009 00000000 00000840 00280004 40008800 02808026 00100000 01001041 00080008 00040000 00000000 08000000 00020000 40000100 08040500 32022000 00000000 00102000 00000000 000c0000 00000080 00008200 00060001 00000000 02024200 |