On Target ADA1D_HUMAN 0.4225352/CHEMBL114669
For the given ligand Acetaminophen, we have found in our database that, being scored 0.4225352, the most similar ligand is CHEMBL114669. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL114669 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | Oc1ccc2cccc(NCC3=NCCN3)c2c1 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00004002 00000008 20224020 04000600 00000000 00000040 12000000 00020000 00000000 00000a43 10220014 40008000 00002022 00002008 00000040 00100008 00040820 00000000 08000000 00020000 40300000 28000008 a0000002 02000002 00020080 00000000 40040000 00000080 08008010 00068000 00800000 00000200 |