On Target CCR1_HUMAN 0.32407406/CHEMBL2208416
For the given ligand Acetaminophen, we have found in our database that, being scored 0.32407406, the most similar ligand is CHEMBL2208416. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL2208416 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | OC(COc1ccccc1NC(=O)C2CCC2)CN3CCC(CC3)Oc4ccc(Cl)c(Cl)c4 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 0401c002 01000008 20100108 00010600 a0001080 02002000 92000000 20000000 00010020 000008c0 002c0004 50019800 06808006 00100012 012a0043 00086408 10240000 00000400 08800000 00020201 40100000 18000700 27402080 08108010 00002001 00100000 20100040 10800080 00008200 00060001 00000400 00022240 |