On Target AA2BR_HUMAN 0.3627451/CHEMBL1814055
For the given ligand Acetaminophen, we have found in our database that, being scored 0.3627451, the most similar ligand is CHEMBL1814055. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL1814055 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | Oc1ccc(NC(=O)C2=CC(=O)c3ccccc3O2)cc1 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00004082 00200808 20080100 00010600 04000200 80000020 02000000 42001200 02004100 40000840 00280014 4000d000 44008c22 00300088 00000060 00000008 00044000 02000000 0a000008 00020000 40100000 08028608 20012000 40580204 08800800 a0000080 04140034 88100080 0000a180 05860001 80040000 00000200 |