On Target 5HT4R_HUMAN 0.29015544/CHEMBL3910849
For the given ligand Xanax, we have found in our database that, being scored 0.29015544, the most similar ligand is CHEMBL3910849. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL3910849 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | COc1cc(N)c(Cl)cc1C(=O)NCC2CCN(Cc3ncc[nH]3)CC2 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 00008002 89001808 20100908 90010e00 00001040 00120100 06000000 22003401 00200100 001008c8 08218004 50038800 02008806 08000000 81020441 000c210c 00000000 02000402 00000000 00020601 40000000 18078700 21000000 0050001c 00102000 c0000400 00100800 90000000 00000304 00460801 e4040000 00020200 |