On Target AA3R_HUMAN 0.4/CHEMBL12
For the given ligand Xanax, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL12. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL12 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | CN1C(=O)CN=C(c2ccccc2)c3cc(Cl)ccc13 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0000c002 04040000 00200120 08010600 40000020 00080040 14000000 01240000 00000300 00090e45 08280024 4000ac00 02008004 00108000 80060040 00180000 02248800 02000001 08008000 00000000 40102000 28000740 20002000 00400010 00002080 a0000000 40080010 45001080 08088098 00068403 40000080 22020600 |