On Target GRM2_HUMAN 0.32178217/CHEMBL3883827
For the given ligand Xanax, we have found in our database that, being scored 0.32178217, the most similar ligand is CHEMBL3883827. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL3883827 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | Clc1c(OCCc2ccccc2)ccn3c(CC4CC4)nnc13 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0400900a 01000008 60004108 18410600 010c0060 02014006 03800000 00200a48 00000100 010c0840 08008004 52808840 0e00080a 01800002 01060040 020c200c 08208000 0680000c 04e00018 80260041 40000400 0c008120 25800802 00600010 00001c00 80008a00 00000000 00010880 00000204 00864002 c0000080 22660400 |