On Target CXCR3_HUMAN 0.26666668/CHEMBL1086280
For the given ligand Xanax, we have found in our database that, being scored 0.26666668, the most similar ligand is CHEMBL1086280. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL1086280 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | Clc1ccc(cc1)S(=O)(=O)N(Cc2ccc(Cc3ccccc3)cc2)Cc4ccccn4 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 00008012 00800200 01084100 11b10e00 000c0020 10100000 04000001 03003001 00000100 00083840 08b12004 60008800 82008806 00000001 90220400 02040104 00002000 02100002 02600000 00006000 c0000000 08008100 20800000 08400018 02102000 e0000004 50000040 c000000c 00000584 20060002 00040000 00034760 |