On Target GRM6_HUMAN 0.1923077/CHEMBL1585091
For the given ligand Xanax, we have found in our database that, being scored 0.1923077, the most similar ligand is CHEMBL1585091. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL1585091 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | COC(=O)c1ccc(cc1)n2c(C)cc(C(=O)CSc3ccc(NC(=O)C)cc3)c2C |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 00004002 00803a00 000a0100 d0190611 00014060 4000c800 00002000 0000100c 00520100 010a48d0 00680004 60018000 80018800 00358200 020200c0 0a0c000c 04060400 82800004 08200500 00000000 c4100000 18068e20 20806001 8740001d 00042000 c0002040 08000000 048018d0 04008206 1006004b d0040200 01010220 |