On Target CXCR2_HUMAN 0.38235295/CHEMBL3927944
For the given ligand suplatast, we have found in our database that, being scored 0.38235295, the most similar ligand is CHEMBL3927944. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL3927944 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | Oc1c(NC(=O)Nc2ccccc2OC(F)(F)F)ccc(Cl)c1S(=O)(=O)C3CCNCC3 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 00009006 05b00208 20120008 02900e40 80001210 00020000 12001000 00002001 00080008 000048c0 00682004 70418840 02018007 00140002 83200141 00004408 04040200 08000000 08000000 00022201 c0000102 18000502 20822208 08050019 0810a880 00080000 20080840 d0800080 02008200 00068021 10000000 03034224 |