On Target HRH1_HUMAN 0.4057971/CHEMBL2158830
For the given ligand suplatast, we have found in our database that, being scored 0.4057971, the most similar ligand is CHEMBL2158830. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL2158830 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | OC(=O)COc1ccc(cc1)N2CCC(CN3CCC(CC3)Oc4ccc(Cl)c(Cl)c4)CC2 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 0400c002 01000008 20100108 00010600 20001000 02002000 92000000 20000008 00200000 000008c0 00240004 5003c800 02808026 00000002 01220043 00082008 00240000 80000400 08800000 00020201 40100000 18000b00 25000080 08100010 00002001 00100000 00140008 10800080 00008200 00060000 00000000 00022240 |