On Target AA3R_HUMAN 0.36585367/CHEMBL24
For the given ligand suplatast, we have found in our database that, being scored 0.36585367, the most similar ligand is CHEMBL24. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL24 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CC(C)NCC(O)COc1ccc(CC(=O)N)cc1 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04000000 00000008 20100108 00010600 00001080 02000000 02040000 00000000 00000000 00080840 08200000 40009000 01808002 00000000 41200001 00082008 10200000 02000000 00800000 00020200 00000000 18000600 07000080 89400010 00000001 80000000 00120000 00800000 04000200 00060002 00002000 00000640 |