On Target OPRX_HUMAN 0.35502958/CHEMBL2064132
For the given ligand suplatast, we have found in our database that, being scored 0.35502958, the most similar ligand is CHEMBL2064132. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL2064132 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CCOc1ccccc1N2CCN(CCC(=O)N3C(Cc4ccccc34)C(=O)N(C)C)CC2 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04004002 00003608 20100128 04010600 a0001000 00000040 02000000 0010000c 00000880 00080be0 083c0024 4000b000 0e808002 00102000 81020141 000c400a 00248000 02000000 08000018 00020201 60100100 38200600 20402021 8340801b 00001800 80000080 20000010 10001080 0c088200 0006001b 20005880 20002600 |