On Target CCKAR_HUMAN 0.35031846/CHEMBL357983
For the given ligand suplatast, we have found in our database that, being scored 0.35031846, the most similar ligand is CHEMBL357983. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL357983 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | COc1ccc(cc1)N(C(C)C)C(=O)CN(C(=O)[C@@H](CCC(=O)O)NC(=O)Nc2ccccc2)c3ccccc3 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 00034006 01003008 20100028 04000e00 20181000 00002000 02000004 20002009 00000000 00020ac0 00280004 4001b000 0600b032 01102001 81020041 00080008 00040010 00400000 08400000 00020201 40100100 38050e00 21022003 0210001a 00110000 00000080 00040000 10000080 08008200 00060001 20085000 00804a00 |