On Target OPRD_HUMAN 0.40268457/CHEMBL2079638
For the given ligand suplatast, we have found in our database that, being scored 0.40268457, the most similar ligand is CHEMBL2079638. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL2079638 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CCC(=O)N1C2CCN(CCc3ccccc3)C[C@H]2COc4ccccc14 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04004002 01001408 20100108 00010700 a0081000 02000000 02000000 20000000 00010080 000809e0 082c0004 50019000 00808002 01100000 11020041 00086408 00a40000 02000000 08c00000 00020201 60140000 18380600 21402080 81508018 00000001 80000000 20000040 10000080 04008200 00060013 00000400 00002640 |