On Target NPY1R_HUMAN 0.34/CHEMBL329997
For the given ligand suplatast, we have found in our database that, being scored 0.34, the most similar ligand is CHEMBL329997. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL329997 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | CC(C)NC(=O)Nc1cccc(CN2C(=O)C(CCc3ccccc23)NC(=O)Nc4ccc5OCCOc5c4)c1 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 14014006 81803208 2010012a 04210e00 34001000 0c002040 03000204 22003009 00902800 080b0ad0 08380024 4001f000 0480f822 08302000 01220441 000c800a 00248110 02400000 0800000a 00022601 c0100100 38058600 24032000 0a54001a 00150000 c0000000 00040010 90801080 08488300 0006000b 200c4080 20424600 |