On Target DRD1_HUMAN 0.35928145/CHEMBL1112
For the given ligand suplatast, we have found in our database that, being scored 0.35928145, the most similar ligand is CHEMBL1112. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL1112 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | Clc1cccc(N2CCN(CCCCOc3ccc4CCC(=O)Nc4c3)CC2)c1Cl |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 0400c002 80000208 20100128 05010700 30101000 06002040 0a040000 28000000 00000800 00080ac0 08380024 40009800 06808006 08102001 11020041 000c2008 00048080 12000000 08400008 00026601 40100100 38000700 21002021 02410012 00002800 81100400 00120210 10001080 08008200 0006000b 00000000 20020e00 |